C21H25ClN6O2 — CID 173499572
tert-butyl N-[[3-[[N-[amino-(2-chloro-4-pyridinyl)methylidene]-N'-ethenylcarbamimidoyl]amino]phenyl]methyl]carbamate (PubChem CID 173499572) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is tert-butyl N-[[3-[[N-[amino-(2-chloro-4-pyridinyl)methylidene]-N'-ethenylcarbamimidoyl]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[N-[amino-(2-chloro-4-pyridinyl)methylidene]-N'-ethenylcarbamimidoyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 173499572 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl N-[[3-[[N-[amino-(2-chloro-4-pyridinyl)methylidene]-N'-ethenylcarbamimidoyl]amino]phenyl]methyl]carbamate |
| SMILES | C=C/N=C(/N=C(N)c1ccnc(Cl)c1)Nc1cccc(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H25ClN6O2/c1-5-24-19(28-18(23)15-9-10-25-17(22)12-15)27-16-8-6-7-14(11-16)13-26-20(29)30-21(2,3)4/h5-12H,1,13H2,2-4H3,(H,26,29)(H3,23,24,27,28) |
| InChIKey | UPIRTPANKAKPLS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|