C26H32BNO7 — CID 169121390
1-O-benzyl 2-O-methyl (2S,4S)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 169121390) has the molecular formula C26H32BNO7 and a molecular weight of 481.35 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,4S)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,4S)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169121390 |
| Molecular Formula | C26H32BNO7 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,4S)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](Oc2cccc(B3OC(C)(C)C(C)(C)O3)c2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H32BNO7/c1-25(2)26(3,4)35-27(34-25)19-12-9-13-20(14-19)33-21-15-22(23(29)31-5)28(16-21)24(30)32-17-18-10-7-6-8-11-18/h6-14,21-22H,15-17H2,1-5H3/t21-,22-/m0/s1 |
| InChIKey | JUDDDGMXJOHYOC-VXKWHMMOSA-N |
| XLogP | 3.32 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|