C15H20N2O3 — CID 102343903
benzyl (2R,3S,6R)-3-amino-6-methoxy-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 102343903) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is benzyl (2R,3S,6R)-3-amino-6-methoxy-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (2R,3S,6R)-3-amino-6-methoxy-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 102343903 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | benzyl (2R,3S,6R)-3-amino-6-methoxy-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CO[C@@H]1C=C[C@H](N)[C@@H](C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-11-13(16)8-9-14(19-2)17(11)15(18)20-10-12-6-4-3-5-7-12/h3-9,11,13-14H,10,16H2,1-2H3/t11-,13+,14-/m1/s1 |
| InChIKey | ZIZDSJNQCNUMCY-KWCYVHTRSA-N |
| XLogP | 1.88 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|