C36H44BNO4 — CID 155793432
tert-butyl (2S,3R)-1-(9-phenylfluoren-9-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]azetidine-2-carboxylate (PubChem CID 155793432) has the molecular formula C36H44BNO4 and a molecular weight of 565.56 g/mol. Its IUPAC name is tert-butyl (2S,3R)-1-(9-phenylfluoren-9-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]azetidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R)-1-(9-phenylfluoren-9-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 155793432 |
| Molecular Formula | C36H44BNO4 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | tert-butyl (2S,3R)-1-(9-phenylfluoren-9-yl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]azetidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H](CCCB2OC(C)(C)C(C)(C)O2)CN1C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H44BNO4/c1-33(2,3)40-32(39)31-25(16-15-23-37-41-34(4,5)35(6,7)42-37)24-38(31)36(26-17-9-8-10-18-26)29-21-13-11-19-27(29)28-20-12-14-22-30(28)36/h8-14,17-22,25,31H,15-16,23-24H2,1-7H3/t25-,31+/m1/s1 |
| InChIKey | JEWIAMLVQBOISS-NJHZRGNWSA-N |
| XLogP | 7.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|