C27H28N2O2 — CID 21341463
methyl (2S)-4-(2-aminoethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate (PubChem CID 21341463) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is methyl (2S)-4-(2-aminoethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-4-(2-aminoethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 21341463 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | methyl (2S)-4-(2-aminoethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(CCN)CN1C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H28N2O2/c1-31-26(30)25-17-19(15-16-28)18-29(25)27(20-9-3-2-4-10-20)23-13-7-5-11-21(23)22-12-6-8-14-24(22)27/h2-14,19,25H,15-18,28H2,1H3/t19?,25-/m0/s1 |
| InChIKey | NSXZLUHTKQEOEZ-BIAFCPFJSA-N |
| XLogP | 4.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |