C34H31NO3S2 — CID 10603041
[(3S,5S)-4,4-dimethyl-1-(9-phenylfluoren-9-yl)-5-phenylmethoxycarbonylpyrrolidin-3-yl]oxymethanedithioic acid (PubChem CID 10603041) has the molecular formula C34H31NO3S2 and a molecular weight of 565.76 g/mol. Its IUPAC name is [(3S,5S)-4,4-dimethyl-1-(9-phenylfluoren-9-yl)-5-phenylmethoxycarbonylpyrrolidin-3-yl]oxymethanedithioic acid.
| Compound Name | [(3S,5S)-4,4-dimethyl-1-(9-phenylfluoren-9-yl)-5-phenylmethoxycarbonylpyrrolidin-3-yl]oxymethanedithioic acid |
|---|---|
| PubChem CID | 10603041 |
| Molecular Formula | C34H31NO3S2 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | [(3S,5S)-4,4-dimethyl-1-(9-phenylfluoren-9-yl)-5-phenylmethoxycarbonylpyrrolidin-3-yl]oxymethanedithioic acid |
| SMILES | CC1(C)[C@H](OC(=S)S)CN(C2(c3ccccc3)c3ccccc3-c3ccccc32)[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H31NO3S2/c1-33(2)29(38-32(39)40)21-35(30(33)31(36)37-22-23-13-5-3-6-14-23)34(24-15-7-4-8-16-24)27-19-11-9-17-25(27)26-18-10-12-20-28(26)34/h3-20,29-30H,21-22H2,1-2H3,(H,39,40)/t29-,30-/m1/s1 |
| InChIKey | YYPFOIIHVWFBKO-LOYHVIPDSA-N |
| XLogP | 7.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|