C24H23NO3 — CID 10948738
(2R,3S,4R)-2-(hydroxymethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-3,4-diol (PubChem CID 10948738) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 10948738 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-1-(9-phenylfluoren-9-yl)pyrrolidine-3,4-diol |
| SMILES | OC[C@@H]1[C@H](O)[C@H](O)CN1C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H23NO3/c26-15-21-23(28)22(27)14-25(21)24(16-8-2-1-3-9-16)19-12-6-4-10-17(19)18-11-5-7-13-20(18)24/h1-13,21-23,26-28H,14-15H2/t21-,22-,23+/m1/s1 |
| InChIKey | JAIMZNXBACBUMW-ZLNRFVROSA-N |
| XLogP | 2.36 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |