C26H26FNO6S2 — CID 169202179
[(2S,3R,4R)-3-fluoro-4-methylsulfonyloxy-1-(9-phenylfluoren-9-yl)pyrrolidin-2-yl]methyl methanesulfonate (PubChem CID 169202179) has the molecular formula C26H26FNO6S2 and a molecular weight of 531.63 g/mol. Its IUPAC name is [(2S,3R,4R)-3-fluoro-4-methylsulfonyloxy-1-(9-phenylfluoren-9-yl)pyrrolidin-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,3R,4R)-3-fluoro-4-methylsulfonyloxy-1-(9-phenylfluoren-9-yl)pyrrolidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 169202179 |
| Molecular Formula | C26H26FNO6S2 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | [(2S,3R,4R)-3-fluoro-4-methylsulfonyloxy-1-(9-phenylfluoren-9-yl)pyrrolidin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1[C@@H](F)[C@H](OS(C)(=O)=O)CN1C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26FNO6S2/c1-35(29,30)33-17-23-25(27)24(34-36(2,31)32)16-28(23)26(18-10-4-3-5-11-18)21-14-8-6-12-19(21)20-13-7-9-15-22(20)26/h3-15,23-25H,16-17H2,1-2H3/t23-,24+,25+/m0/s1 |
| InChIKey | WBTCFTQRBSCRFT-ISJGIBHGSA-N |
| XLogP | 3.30 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|