C35H33NO3S2 — CID 10840975
benzyl (2S,4S)-3,3-dimethyl-4-methylsulfanylcarbothioyloxy-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate (PubChem CID 10840975) has the molecular formula C35H33NO3S2 and a molecular weight of 579.79 g/mol. Its IUPAC name is benzyl (2S,4S)-3,3-dimethyl-4-methylsulfanylcarbothioyloxy-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S,4S)-3,3-dimethyl-4-methylsulfanylcarbothioyloxy-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10840975 |
| Molecular Formula | C35H33NO3S2 |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | benzyl (2S,4S)-3,3-dimethyl-4-methylsulfanylcarbothioyloxy-1-(9-phenylfluoren-9-yl)pyrrolidine-2-carboxylate |
| SMILES | CSC(=S)O[C@@H]1CN(C2(c3ccccc3)c3ccccc3-c3ccccc32)[C@H](C(=O)OCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C35H33NO3S2/c1-34(2)30(39-33(40)41-3)22-36(31(34)32(37)38-23-24-14-6-4-7-15-24)35(25-16-8-5-9-17-25)28-20-12-10-18-26(28)27-19-11-13-21-29(27)35/h4-21,30-31H,22-23H2,1-3H3/t30-,31-/m1/s1 |
| InChIKey | WRLMHJYWDFSYTQ-FIRIVFDPSA-N |
| XLogP | 7.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|