C30H31NO2 — CID 139490263
tert-butyl 1-(9-phenylfluoren-9-yl)-3-prop-2-enylazetidine-2-carboxylate (PubChem CID 139490263) has the molecular formula C30H31NO2 and a molecular weight of 437.58 g/mol. Its IUPAC name is tert-butyl 1-(9-phenylfluoren-9-yl)-3-prop-2-enylazetidine-2-carboxylate.
| Compound Name | tert-butyl 1-(9-phenylfluoren-9-yl)-3-prop-2-enylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 139490263 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | tert-butyl 1-(9-phenylfluoren-9-yl)-3-prop-2-enylazetidine-2-carboxylate |
| SMILES | C=CCC1CN(C2(c3ccccc3)c3ccccc3-c3ccccc32)C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H31NO2/c1-5-13-21-20-31(27(21)28(32)33-29(2,3)4)30(22-14-7-6-8-15-22)25-18-11-9-16-23(25)24-17-10-12-19-26(24)30/h5-12,14-19,21,27H,1,13,20H2,2-4H3 |
| InChIKey | DWNVBBKZQUDDCA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|