C21H30N2O4 — CID 155793323
1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(benzylamino)-3-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 155793323) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(benzylamino)-3-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(benzylamino)-3-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793323 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(benzylamino)-3-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@@H]1[C@@H](NCc2ccccc2)CN(C(=O)OC(C)(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C21H30N2O4/c1-6-10-16-17(22-13-15-11-8-7-9-12-15)14-23(18(16)19(24)26-5)20(25)27-21(2,3)4/h6-9,11-12,16-18,22H,1,10,13-14H2,2-5H3/t16-,17+,18+/m1/s1 |
| InChIKey | GBJMCSHFFUAHCE-SQNIBIBYSA-N |
| XLogP | 3.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|