C22H32N2O2 — CID 11581219
tert-butyl (1R,2S,5S)-7-benzyl-2-prop-2-enyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 11581219) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl (1R,2S,5S)-7-benzyl-2-prop-2-enyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | tert-butyl (1R,2S,5S)-7-benzyl-2-prop-2-enyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 11581219 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tert-butyl (1R,2S,5S)-7-benzyl-2-prop-2-enyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | C=CC[C@H]1[C@@H]2C[C@@H](CN(Cc3ccccc3)C2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O2/c1-5-9-20-19-12-18(15-24(20)21(25)26-22(2,3)4)14-23(16-19)13-17-10-7-6-8-11-17/h5-8,10-11,18-20H,1,9,12-16H2,2-4H3/t18-,19+,20-/m0/s1 |
| InChIKey | KJAVQAFXHQXUAS-ZCNNSNEGSA-N |
| XLogP | 4.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|