C24H45BN2O6 — CID 155793174
1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(diethylamino)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 155793174) has the molecular formula C24H45BN2O6 and a molecular weight of 468.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(diethylamino)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(diethylamino)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793174 |
| Molecular Formula | C24H45BN2O6 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3R,4R)-4-(diethylamino)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | CCN(CC)[C@H]1CN(C(=O)OC(C)(C)C)[C@H](C(=O)OC)[C@@H]1CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H45BN2O6/c1-11-26(12-2)18-16-27(21(29)31-22(3,4)5)19(20(28)30-10)17(18)14-13-15-25-32-23(6,7)24(8,9)33-25/h17-19H,11-16H2,1-10H3/t17-,18+,19+/m1/s1 |
| InChIKey | LSDYCGYYRZAJJC-QYZOEREBSA-N |
| XLogP | 3.98 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|