C23H33BFNO5 — CID 67678651
methyl (3S,4R)-1-(4-fluorobenzoyl)-3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate (PubChem CID 67678651) has the molecular formula C23H33BFNO5 and a molecular weight of 433.33 g/mol. Its IUPAC name is methyl (3S,4R)-1-(4-fluorobenzoyl)-3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-1-(4-fluorobenzoyl)-3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 67678651 |
| Molecular Formula | C23H33BFNO5 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | methyl (3S,4R)-1-(4-fluorobenzoyl)-3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@]1(C)CN(C(=O)c2ccc(F)cc2)C[C@@H]1CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H33BFNO5/c1-21(2)22(3,4)31-24(30-21)13-7-8-17-14-26(15-23(17,5)20(28)29-6)19(27)16-9-11-18(25)12-10-16/h9-12,17H,7-8,13-15H2,1-6H3/t17-,23+/m0/s1 |
| InChIKey | BEDRRTBYIHDVJC-GAJHUEQPSA-N |
| XLogP | 3.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|