C20H37BN2O6 — CID 167604011
tert-butyl (2S,3S)-2-acetamido-3-(methylcarbamoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 167604011) has the molecular formula C20H37BN2O6 and a molecular weight of 412.34 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-acetamido-3-(methylcarbamoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl (2S,3S)-2-acetamido-3-(methylcarbamoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 167604011 |
| Molecular Formula | C20H37BN2O6 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | tert-butyl (2S,3S)-2-acetamido-3-(methylcarbamoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CNC(=O)[C@@H](CCCB1OC(C)(C)C(C)(C)O1)[C@H](NC(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37BN2O6/c1-13(24)23-15(17(26)27-18(2,3)4)14(16(25)22-9)11-10-12-21-28-19(5,6)20(7,8)29-21/h14-15H,10-12H2,1-9H3,(H,22,25)(H,23,24)/t14-,15-/m0/s1 |
| InChIKey | MNEXQVXURWHXQY-GJZGRUSLSA-N |
| XLogP | 2.07 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|