C30H51BN2O6 — CID 123274116
ethyl (2R)-2-[2-[benzyl(ethyl)amino]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 123274116) has the molecular formula C30H51BN2O6 and a molecular weight of 546.56 g/mol. Its IUPAC name is ethyl (2R)-2-[2-[benzyl(ethyl)amino]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | ethyl (2R)-2-[2-[benzyl(ethyl)amino]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 123274116 |
| Molecular Formula | C30H51BN2O6 |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | ethyl (2R)-2-[2-[benzyl(ethyl)amino]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CCOC(=O)[C@@](CCCCB1OC(C)(C)C(C)(C)O1)(CCN(CC)Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H51BN2O6/c1-10-33(23-24-17-13-12-14-18-24)22-20-30(25(34)36-11-2,32-26(35)37-27(3,4)5)19-15-16-21-31-38-28(6,7)29(8,9)39-31/h12-14,17-18H,10-11,15-16,19-23H2,1-9H3,(H,32,35)/t30-/m1/s1 |
| InChIKey | BCUVGNPLXKLLLQ-SSEXGKCCSA-N |
| XLogP | 5.99 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|