C38H50BNO5 — CID 59413841
tert-butyl 2-(benzhydrylideneamino)-2-(3-phenoxypropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 59413841) has the molecular formula C38H50BNO5 and a molecular weight of 611.63 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-2-(3-phenoxypropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-2-(3-phenoxypropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 59413841 |
| Molecular Formula | C38H50BNO5 |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.38 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-2-(3-phenoxypropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCCB1OC(C)(C)C(C)(C)O1)(CCCOc1ccccc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H50BNO5/c1-35(2,3)43-34(41)38(27-19-29-42-32-24-15-10-16-25-32,26-17-18-28-39-44-36(4,5)37(6,7)45-39)40-33(30-20-11-8-12-21-30)31-22-13-9-14-23-31/h8-16,20-25H,17-19,26-29H2,1-7H3 |
| InChIKey | NYCUDEMNYKQGFL-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|