C26H33NO2 — CID 174708236
tert-butyl 2-(benzhydrylideneamino)-2-propylhex-4-enoate (PubChem CID 174708236) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-2-propylhex-4-enoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-2-propylhex-4-enoate |
|---|---|
| PubChem CID | 174708236 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-2-propylhex-4-enoate |
| SMILES | CC=CCC(CCC)(N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H33NO2/c1-6-8-20-26(19-7-2,24(28)29-25(3,4)5)27-23(21-15-11-9-12-16-21)22-17-13-10-14-18-22/h6,8-18H,7,19-20H2,1-5H3 |
| InChIKey | LQGIYICTHJHUHT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|