C42H56BCl2N3O4 — CID 88856092
tert-butyl 2-(benzhydrylideneamino)-2-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 88856092) has the molecular formula C42H56BCl2N3O4 and a molecular weight of 748.65 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-2-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-2-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 88856092 |
| Molecular Formula | C42H56BCl2N3O4 |
| Molecular Weight | 748.65 g/mol |
| Exact Mass | 747.37 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-2-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCCB1OC(C)(C)C(C)(C)O1)(CCCN1CCN(c2ccc(Cl)c(Cl)c2)CC1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H56BCl2N3O4/c1-39(2,3)50-38(49)42(23-14-15-25-43-51-40(4,5)41(6,7)52-43,46-37(32-17-10-8-11-18-32)33-19-12-9-13-20-33)24-16-26-47-27-29-48(30-28-47)34-21-22-35(44)36(45)31-34/h8-13,17-22,31H,14-16,23-30H2,1-7H3 |
| InChIKey | MMUZWLDKPMQMOZ-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.65 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|