C35H49N3O4 — CID 88856087
tert-butyl 4-[(E)-4-(benzhydrylideneamino)-4-[(2-methylpropan-2-yl)oxycarbonyl]oct-6-enyl]piperazine-1-carboxylate (PubChem CID 88856087) has the molecular formula C35H49N3O4 and a molecular weight of 575.79 g/mol. Its IUPAC name is tert-butyl 4-[(E)-4-(benzhydrylideneamino)-4-[(2-methylpropan-2-yl)oxycarbonyl]oct-6-enyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-4-(benzhydrylideneamino)-4-[(2-methylpropan-2-yl)oxycarbonyl]oct-6-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88856087 |
| Molecular Formula | C35H49N3O4 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.37 |
| IUPAC Name | tert-butyl 4-[(E)-4-(benzhydrylideneamino)-4-[(2-methylpropan-2-yl)oxycarbonyl]oct-6-enyl]piperazine-1-carboxylate |
| SMILES | C/C=C/CC(CCCN1CCN(C(=O)OC(C)(C)C)CC1)(N=C(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H49N3O4/c1-8-9-21-35(31(39)41-33(2,3)4,36-30(28-17-12-10-13-18-28)29-19-14-11-15-20-29)22-16-23-37-24-26-38(27-25-37)32(40)42-34(5,6)7/h8-15,17-20H,16,21-27H2,1-7H3/b9-8+ |
| InChIKey | RZLNTXPXXBADDI-CMDGGOBGSA-N |
| XLogP | 6.90 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|