C19H33BN2O6 — CID 145113727
2-cyano-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid (PubChem CID 145113727) has the molecular formula C19H33BN2O6 and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-cyano-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid.
| Compound Name | 2-cyano-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 145113727 |
| Molecular Formula | C19H33BN2O6 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-cyano-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
| SMILES | CN(C(=O)OC(C)(C)C)C(C#N)(CCCCB1OC(C)(C)C(C)(C)O1)C(=O)O |
| InChI | InChI=1S/C19H33BN2O6/c1-16(2,3)26-15(25)22(8)19(13-21,14(23)24)11-9-10-12-20-27-17(4,5)18(6,7)28-20/h9-12H2,1-8H3,(H,23,24) |
| InChIKey | XJFTUVSHJVVFSS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|