C15H27NO6 — CID 11056213
(5R)-5-ethoxycarbonyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (PubChem CID 11056213) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is (5R)-5-ethoxycarbonyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid.
| Compound Name | (5R)-5-ethoxycarbonyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
|---|---|
| PubChem CID | 11056213 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (5R)-5-ethoxycarbonyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
| SMILES | CCOC(=O)[C@@](CC)(CCCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO6/c1-6-15(12(19)21-7-2,10-8-9-11(17)18)16-13(20)22-14(3,4)5/h6-10H2,1-5H3,(H,16,20)(H,17,18)/t15-/m1/s1 |
| InChIKey | PGXSTGPXFNCRRX-OAHLLOKOSA-N |
| XLogP | 2.48 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |