C17H31NO6 — CID 21327015
2-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]octanedioic acid (PubChem CID 21327015) has the molecular formula C17H31NO6 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]octanedioic acid.
| Compound Name | 2-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]octanedioic acid |
|---|---|
| PubChem CID | 21327015 |
| Molecular Formula | C17H31NO6 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]octanedioic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCCC(=O)O)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H31NO6/c1-15(2,3)17(13(21)22,11-9-7-8-10-12(19)20)18-14(23)24-16(4,5)6/h7-11H2,1-6H3,(H,18,23)(H,19,20)(H,21,22) |
| InChIKey | AIMSPUFLAPBTGD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|