C15H28FNO3 — CID 149379018
tert-butyl N-(3-ethyl-8-fluoro-4-oxooctan-3-yl)carbamate (PubChem CID 149379018) has the molecular formula C15H28FNO3 and a molecular weight of 289.39 g/mol. Its IUPAC name is tert-butyl N-(3-ethyl-8-fluoro-4-oxooctan-3-yl)carbamate.
| Compound Name | tert-butyl N-(3-ethyl-8-fluoro-4-oxooctan-3-yl)carbamate |
|---|---|
| PubChem CID | 149379018 |
| Molecular Formula | C15H28FNO3 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | tert-butyl N-(3-ethyl-8-fluoro-4-oxooctan-3-yl)carbamate |
| SMILES | CCC(CC)(NC(=O)OC(C)(C)C)C(=O)CCCCF |
| InChI | InChI=1S/C15H28FNO3/c1-6-15(7-2,12(18)10-8-9-11-16)17-13(19)20-14(3,4)5/h6-11H2,1-5H3,(H,17,19) |
| InChIKey | YLHALJUPZXIJLB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|