C9H18FNO4S — CID 153002934
tert-butyl N-(4-fluorobutylsulfonyl)carbamate (PubChem CID 153002934) has the molecular formula C9H18FNO4S and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl N-(4-fluorobutylsulfonyl)carbamate.
| Compound Name | tert-butyl N-(4-fluorobutylsulfonyl)carbamate |
|---|---|
| PubChem CID | 153002934 |
| Molecular Formula | C9H18FNO4S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | tert-butyl N-(4-fluorobutylsulfonyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)CCCCF |
| InChI | InChI=1S/C9H18FNO4S/c1-9(2,3)15-8(12)11-16(13,14)7-5-4-6-10/h4-7H2,1-3H3,(H,11,12) |
| InChIKey | UYNCSBPHRGWQHN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|