C10H20N2O5S — CID 89271314
tert-butyl N-[2-oxo-2-(propylamino)ethyl]sulfonylcarbamate (PubChem CID 89271314) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-(propylamino)ethyl]sulfonylcarbamate.
| Compound Name | tert-butyl N-[2-oxo-2-(propylamino)ethyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 89271314 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | tert-butyl N-[2-oxo-2-(propylamino)ethyl]sulfonylcarbamate |
| SMILES | CCCNC(=O)CS(=O)(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O5S/c1-5-6-11-8(13)7-18(15,16)12-9(14)17-10(2,3)4/h5-7H2,1-4H3,(H,11,13)(H,12,14) |
| InChIKey | VJLCTSZMSJHBAJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |