C10H15BrF3NO3 — CID 104701574
tert-butyl N-(4-bromo-1,1,1-trifluoro-2-methyl-3-oxobutan-2-yl)carbamate (PubChem CID 104701574) has the molecular formula C10H15BrF3NO3 and a molecular weight of 334.13 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-1,1,1-trifluoro-2-methyl-3-oxobutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-bromo-1,1,1-trifluoro-2-methyl-3-oxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 104701574 |
| Molecular Formula | C10H15BrF3NO3 |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | tert-butyl N-(4-bromo-1,1,1-trifluoro-2-methyl-3-oxobutan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C(=O)CBr)C(F)(F)F |
| InChI | InChI=1S/C10H15BrF3NO3/c1-8(2,3)18-7(17)15-9(4,6(16)5-11)10(12,13)14/h5H2,1-4H3,(H,15,17) |
| InChIKey | KJSWMUXLOXFRKL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|