C11H22BrNO2 — CID 130802428
tert-butyl N-(1-bromo-2,3-dimethylbutan-2-yl)carbamate (PubChem CID 130802428) has the molecular formula C11H22BrNO2 and a molecular weight of 280.21 g/mol. Its IUPAC name is tert-butyl N-(1-bromo-2,3-dimethylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-bromo-2,3-dimethylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 130802428 |
| Molecular Formula | C11H22BrNO2 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | tert-butyl N-(1-bromo-2,3-dimethylbutan-2-yl)carbamate |
| SMILES | CC(C)C(C)(CBr)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22BrNO2/c1-8(2)11(6,7-12)13-9(14)15-10(3,4)5/h8H,7H2,1-6H3,(H,13,14) |
| InChIKey | XCHCAPDAQKVTPL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|