C8H11F6NO3 — CID 22282534
tert-butyl N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)carbamate (PubChem CID 22282534) has the molecular formula C8H11F6NO3 and a molecular weight of 283.17 g/mol. Its IUPAC name is tert-butyl N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 22282534 |
| Molecular Formula | C8H11F6NO3 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | tert-butyl N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H11F6NO3/c1-5(2,3)18-4(16)15-6(17,7(9,10)11)8(12,13)14/h17H,1-3H3,(H,15,16) |
| InChIKey | BHPIIGCIWZJPGA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|