C16H31N3O5 — CID 54526921
ethyl 6-[1-(hydroxyamino)ethylideneamino]-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 54526921) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 6-[1-(hydroxyamino)ethylideneamino]-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | ethyl 6-[1-(hydroxyamino)ethylideneamino]-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 54526921 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | ethyl 6-[1-(hydroxyamino)ethylideneamino]-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCOC(=O)C(C)(CCCC/N=C(\C)NO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N3O5/c1-7-23-13(20)16(6,18-14(21)24-15(3,4)5)10-8-9-11-17-12(2)19-22/h22H,7-11H2,1-6H3,(H,17,19)(H,18,21) |
| InChIKey | YTTSSUBBNJEJQQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|