C16H30N8O3 — CID 54294959
tert-butyl N-[6-(1-aminoethylideneamino)-2-methyl-1-[methyl(2H-tetrazol-5-yl)amino]-1-oxohexan-2-yl]carbamate (PubChem CID 54294959) has the molecular formula C16H30N8O3 and a molecular weight of 382.47 g/mol. Its IUPAC name is tert-butyl N-[6-(1-aminoethylideneamino)-2-methyl-1-[methyl(2H-tetrazol-5-yl)amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-(1-aminoethylideneamino)-2-methyl-1-[methyl(2H-tetrazol-5-yl)amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 54294959 |
| Molecular Formula | C16H30N8O3 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | tert-butyl N-[6-(1-aminoethylideneamino)-2-methyl-1-[methyl(2H-tetrazol-5-yl)amino]-1-oxohexan-2-yl]carbamate |
| SMILES | C/C(N)=N\CCCCC(C)(NC(=O)OC(C)(C)C)C(=O)N(C)c1nn[nH]n1 |
| InChI | InChI=1S/C16H30N8O3/c1-11(17)18-10-8-7-9-16(5,19-14(26)27-15(2,3)4)12(25)24(6)13-20-22-23-21-13/h7-10H2,1-6H3,(H2,17,18)(H,19,26)(H,20,21,22,23) |
| InChIKey | SADWFPCIJDUHJF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|