C25H39N3O9 — CID 175821789
2-[[(2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 175821789) has the molecular formula C25H39N3O9 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[[(2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 2-[[(2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 175821789 |
| Molecular Formula | C25H39N3O9 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 2-[[(2S)-3-(3,4-dihydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CCCCC(NC(=O)OC(C)(C)C)(NC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C25H39N3O9/c1-8-9-12-25(20(32)33,28-22(35)37-24(5,6)7)27-19(31)16(26-21(34)36-23(2,3)4)13-15-10-11-17(29)18(30)14-15/h10-11,14,16,29-30H,8-9,12-13H2,1-7H3,(H,26,34)(H,27,31)(H,28,35)(H,32,33)/t16-,25?/m0/s1 |
| InChIKey | ACWYVHGQBIGGRV-YPHZTSLFSA-N |
| XLogP | 3.15 |
| TPSA | 183.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|