C24H31IN2O4 — CID 59897167
tert-butyl N-[(2S)-3-(4-hydroxy-3-iodophenyl)-1-oxo-1-(4-phenylbutylamino)propan-2-yl]carbamate (PubChem CID 59897167) has the molecular formula C24H31IN2O4 and a molecular weight of 538.43 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-(4-hydroxy-3-iodophenyl)-1-oxo-1-(4-phenylbutylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-(4-hydroxy-3-iodophenyl)-1-oxo-1-(4-phenylbutylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59897167 |
| Molecular Formula | C24H31IN2O4 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | tert-butyl N-[(2S)-3-(4-hydroxy-3-iodophenyl)-1-oxo-1-(4-phenylbutylamino)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O)c(I)c1)C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C24H31IN2O4/c1-24(2,3)31-23(30)27-20(16-18-12-13-21(28)19(25)15-18)22(29)26-14-8-7-11-17-9-5-4-6-10-17/h4-6,9-10,12-13,15,20,28H,7-8,11,14,16H2,1-3H3,(H,26,29)(H,27,30)/t20-/m0/s1 |
| InChIKey | DMVWXSPNMBCFRF-FQEVSTJZSA-N |
| XLogP | 4.57 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|