C18H26N2O6 — CID 22865435
tert-butyl N-[(2S)-3-(3,4-dihydroxyphenyl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate (PubChem CID 22865435) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-(3,4-dihydroxyphenyl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-(3,4-dihydroxyphenyl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22865435 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | tert-butyl N-[(2S)-3-(3,4-dihydroxyphenyl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O)c(O)c1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O6/c1-18(2,3)26-17(24)19-13(16(23)20-6-8-25-9-7-20)10-12-4-5-14(21)15(22)11-12/h4-5,11,13,21-22H,6-10H2,1-3H3,(H,19,24)/t13-/m0/s1 |
| InChIKey | COOFJETXQVYTKY-ZDUSSCGKSA-N |
| XLogP | 1.39 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|