C21H28N4O4 — CID 90841250
tert-butyl N-[3-(1-aminoisoquinolin-6-yl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate (PubChem CID 90841250) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl N-[3-(1-aminoisoquinolin-6-yl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(1-aminoisoquinolin-6-yl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90841250 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | tert-butyl N-[3-(1-aminoisoquinolin-6-yl)-1-morpholin-4-yl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc2c(N)nccc2c1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H28N4O4/c1-21(2,3)29-20(27)24-17(19(26)25-8-10-28-11-9-25)13-14-4-5-16-15(12-14)6-7-23-18(16)22/h4-7,12,17H,8-11,13H2,1-3H3,(H2,22,23)(H,24,27) |
| InChIKey | IJPJNSFDJYOTMU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |