C21H33N5O3 — CID 70477800
tert-butyl N-[(2S)-3-[4-(diaminomethylideneamino)phenyl]-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 70477800) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[4-(diaminomethylideneamino)phenyl]-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[4-(diaminomethylideneamino)phenyl]-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70477800 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | tert-butyl N-[(2S)-3-[4-(diaminomethylideneamino)phenyl]-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC1CCN(C(=O)[C@H](Cc2ccc(N=C(N)N)cc2)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H33N5O3/c1-14-9-11-26(12-10-14)18(27)17(25-20(28)29-21(2,3)4)13-15-5-7-16(8-6-15)24-19(22)23/h5-8,14,17H,9-13H2,1-4H3,(H,25,28)(H4,22,23,24)/t17-/m0/s1 |
| InChIKey | NXCADZGEJXNKEH-KRWDZBQOSA-N |
| XLogP | 2.29 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|