C12H12BrF3O4 — CID 64757113
methyl 2-(2-bromo-3,3,3-trifluoropropoxy)-4-methoxybenzoate (PubChem CID 64757113) has the molecular formula C12H12BrF3O4 and a molecular weight of 357.12 g/mol. Its IUPAC name is methyl 2-(2-bromo-3,3,3-trifluoropropoxy)-4-methoxybenzoate.
| Compound Name | methyl 2-(2-bromo-3,3,3-trifluoropropoxy)-4-methoxybenzoate |
|---|---|
| PubChem CID | 64757113 |
| Molecular Formula | C12H12BrF3O4 |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | methyl 2-(2-bromo-3,3,3-trifluoropropoxy)-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)cc1OCC(Br)C(F)(F)F |
| InChI | InChI=1S/C12H12BrF3O4/c1-18-7-3-4-8(11(17)19-2)9(5-7)20-6-10(13)12(14,15)16/h3-5,10H,6H2,1-2H3 |
| InChIKey | SFXXZLCRIQVYNF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|