C16H17F5O8S — CID 134481349
dimethyl 4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]benzene-1,2-dicarboxylate (PubChem CID 134481349) has the molecular formula C16H17F5O8S and a molecular weight of 464.36 g/mol. Its IUPAC name is dimethyl 4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134481349 |
| Molecular Formula | C16H17F5O8S |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | dimethyl 4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OCCCC(F)(F)COS(=O)(=O)C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C16H17F5O8S/c1-26-13(22)11-5-4-10(8-12(11)14(23)27-2)28-7-3-6-15(17,18)9-29-30(24,25)16(19,20)21/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | KXERZVZQXIVGDN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|