C14H13F5O8S — CID 134481667
4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]phthalic acid (PubChem CID 134481667) has the molecular formula C14H13F5O8S and a molecular weight of 436.31 g/mol. Its IUPAC name is 4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]phthalic acid.
| Compound Name | 4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]phthalic acid |
|---|---|
| PubChem CID | 134481667 |
| Molecular Formula | C14H13F5O8S |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 4-[4,4-difluoro-5-(trifluoromethylsulfonyloxy)pentoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(OCCCC(F)(F)COS(=O)(=O)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C14H13F5O8S/c15-13(16,7-27-28(24,25)14(17,18)19)4-1-5-26-8-2-3-9(11(20)21)10(6-8)12(22)23/h2-3,6H,1,4-5,7H2,(H,20,21)(H,22,23) |
| InChIKey | YCCNATCUGGHJBV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|