C22H36BrNO3 — CID 14327271
6-[4-(5-bromopentoxy)phenoxy]-2,2-dimethyl-N-propan-2-ylhexanamide (PubChem CID 14327271) has the molecular formula C22H36BrNO3 and a molecular weight of 442.44 g/mol. Its IUPAC name is 6-[4-(5-bromopentoxy)phenoxy]-2,2-dimethyl-N-propan-2-ylhexanamide.
| Compound Name | 6-[4-(5-bromopentoxy)phenoxy]-2,2-dimethyl-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 14327271 |
| Molecular Formula | C22H36BrNO3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 6-[4-(5-bromopentoxy)phenoxy]-2,2-dimethyl-N-propan-2-ylhexanamide |
| SMILES | CC(C)NC(=O)C(C)(C)CCCCOc1ccc(OCCCCCBr)cc1 |
| InChI | InChI=1S/C22H36BrNO3/c1-18(2)24-21(25)22(3,4)14-6-9-17-27-20-12-10-19(11-13-20)26-16-8-5-7-15-23/h10-13,18H,5-9,14-17H2,1-4H3,(H,24,25) |
| InChIKey | SKAZKPSWEQNXFL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|