C17H26BrNO3 — CID 151595726
[3-[4-(5-bromopentoxy)phenyl]-2-methylbutan-2-yl] carbamate (PubChem CID 151595726) has the molecular formula C17H26BrNO3 and a molecular weight of 372.30 g/mol. Its IUPAC name is [3-[4-(5-bromopentoxy)phenyl]-2-methylbutan-2-yl] carbamate.
| Compound Name | [3-[4-(5-bromopentoxy)phenyl]-2-methylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 151595726 |
| Molecular Formula | C17H26BrNO3 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [3-[4-(5-bromopentoxy)phenyl]-2-methylbutan-2-yl] carbamate |
| SMILES | CC(c1ccc(OCCCCCBr)cc1)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C17H26BrNO3/c1-13(17(2,3)22-16(19)20)14-7-9-15(10-8-14)21-12-6-4-5-11-18/h7-10,13H,4-6,11-12H2,1-3H3,(H2,19,20) |
| InChIKey | QJKVDJIFOAXNJY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|