C20H25NO3 — CID 18987297
methyl 2,2-dimethyl-6-[(4-phenyl-2-pyridinyl)oxy]hexanoate (PubChem CID 18987297) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl 2,2-dimethyl-6-[(4-phenyl-2-pyridinyl)oxy]hexanoate.
| Compound Name | methyl 2,2-dimethyl-6-[(4-phenyl-2-pyridinyl)oxy]hexanoate |
|---|---|
| PubChem CID | 18987297 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl 2,2-dimethyl-6-[(4-phenyl-2-pyridinyl)oxy]hexanoate |
| SMILES | COC(=O)C(C)(C)CCCCOc1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C20H25NO3/c1-20(2,19(22)23-3)12-7-8-14-24-18-15-17(11-13-21-18)16-9-5-4-6-10-16/h4-6,9-11,13,15H,7-8,12,14H2,1-3H3 |
| InChIKey | VKPSBRCOEKSHJC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|