C20H24ClNO3 — CID 18987383
methyl 6-[[4-(4-chlorophenyl)-2-pyridinyl]oxy]-2,2-dimethylhexanoate (PubChem CID 18987383) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is methyl 6-[[4-(4-chlorophenyl)-2-pyridinyl]oxy]-2,2-dimethylhexanoate.
| Compound Name | methyl 6-[[4-(4-chlorophenyl)-2-pyridinyl]oxy]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 18987383 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | methyl 6-[[4-(4-chlorophenyl)-2-pyridinyl]oxy]-2,2-dimethylhexanoate |
| SMILES | COC(=O)C(C)(C)CCCCOc1cc(-c2ccc(Cl)cc2)ccn1 |
| InChI | InChI=1S/C20H24ClNO3/c1-20(2,19(23)24-3)11-4-5-13-25-18-14-16(10-12-22-18)15-6-8-17(21)9-7-15/h6-10,12,14H,4-5,11,13H2,1-3H3 |
| InChIKey | SDDDHWABIFEBGA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|