C21H20O5S — CID 54406005
4-methyl-2-[2-(4-phenoxyphenoxy)ethyl]benzenesulfonic acid (PubChem CID 54406005) has the molecular formula C21H20O5S and a molecular weight of 384.45 g/mol. Its IUPAC name is 4-methyl-2-[2-(4-phenoxyphenoxy)ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-(4-phenoxyphenoxy)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54406005 |
| Molecular Formula | C21H20O5S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-methyl-2-[2-(4-phenoxyphenoxy)ethyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H20O5S/c1-16-7-12-21(27(22,23)24)17(15-16)13-14-25-18-8-10-20(11-9-18)26-19-5-3-2-4-6-19/h2-12,15H,13-14H2,1H3,(H,22,23,24) |
| InChIKey | VQSIEOOXPUCMQC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|