C13H19N3O5S — CID 175497204
2-[2-[2-(1-azidoethoxy)ethoxy]ethyl]-4-methylbenzenesulfonic acid (PubChem CID 175497204) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-[2-[2-(1-azidoethoxy)ethoxy]ethyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[2-(1-azidoethoxy)ethoxy]ethyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175497204 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[2-[2-(1-azidoethoxy)ethoxy]ethyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOCCOC(C)N=[N+]=[N-])c1 |
| InChI | InChI=1S/C13H19N3O5S/c1-10-3-4-13(22(17,18)19)12(9-10)5-6-20-7-8-21-11(2)15-16-14/h3-4,9,11H,5-8H2,1-2H3,(H,17,18,19) |
| InChIKey | UYEAQQWAUNQGDR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|