C13H15NO4S — CID 173060595
2-(hydroxymethyl)-4-methylbenzenesulfonic acid;pyridine (PubChem CID 173060595) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-methylbenzenesulfonic acid;pyridine.
| Compound Name | 2-(hydroxymethyl)-4-methylbenzenesulfonic acid;pyridine |
|---|---|
| PubChem CID | 173060595 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-(hydroxymethyl)-4-methylbenzenesulfonic acid;pyridine |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CO)c1.c1ccncc1 |
| InChI | InChI=1S/C8H10O4S.C5H5N/c1-6-2-3-8(13(10,11)12)7(4-6)5-9;1-2-4-6-5-3-1/h2-4,9H,5H2,1H3,(H,10,11,12);1-5H |
| InChIKey | AIQYGGVUHVBSAV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|