C20H34N2O — CID 59549336
3-[[4-[[(2,5-dimethylphenyl)methylamino]methyl]cyclohexyl]methylamino]propan-1-ol (PubChem CID 59549336) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is 3-[[4-[[(2,5-dimethylphenyl)methylamino]methyl]cyclohexyl]methylamino]propan-1-ol.
| Compound Name | 3-[[4-[[(2,5-dimethylphenyl)methylamino]methyl]cyclohexyl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 59549336 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 3-[[4-[[(2,5-dimethylphenyl)methylamino]methyl]cyclohexyl]methylamino]propan-1-ol |
| SMILES | Cc1ccc(C)c(CNCC2CCC(CNCCCO)CC2)c1 |
| InChI | InChI=1S/C20H34N2O/c1-16-4-5-17(2)20(12-16)15-22-14-19-8-6-18(7-9-19)13-21-10-3-11-23/h4-5,12,18-19,21-23H,3,6-11,13-15H2,1-2H3 |
| InChIKey | DHWNKOIHMAQXHQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|