C15H26N2 — CID 115136129
2-methyl-1-N-[2-(2,4,6-trimethylphenyl)ethyl]propane-1,2-diamine (PubChem CID 115136129) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-methyl-1-N-[2-(2,4,6-trimethylphenyl)ethyl]propane-1,2-diamine.
| Compound Name | 2-methyl-1-N-[2-(2,4,6-trimethylphenyl)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 115136129 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-methyl-1-N-[2-(2,4,6-trimethylphenyl)ethyl]propane-1,2-diamine |
| SMILES | Cc1cc(C)c(CCNCC(C)(C)N)c(C)c1 |
| InChI | InChI=1S/C15H26N2/c1-11-8-12(2)14(13(3)9-11)6-7-17-10-15(4,5)16/h8-9,17H,6-7,10,16H2,1-5H3 |
| InChIKey | KOMDDAHDAZJOCF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|