C15H25NO — CID 96661132
2-methyl-1-[2-(2,4,6-trimethylphenyl)ethylamino]propan-2-ol (PubChem CID 96661132) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-methyl-1-[2-(2,4,6-trimethylphenyl)ethylamino]propan-2-ol.
| Compound Name | 2-methyl-1-[2-(2,4,6-trimethylphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 96661132 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-methyl-1-[2-(2,4,6-trimethylphenyl)ethylamino]propan-2-ol |
| SMILES | Cc1cc(C)c(CCNCC(C)(C)O)c(C)c1 |
| InChI | InChI=1S/C15H25NO/c1-11-8-12(2)14(13(3)9-11)6-7-16-10-15(4,5)17/h8-9,16-17H,6-7,10H2,1-5H3 |
| InChIKey | VXELOURNEOMHPQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|