C11H13F2NO — CID 141136392
2-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]ethanol (PubChem CID 141136392) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]ethanol.
| Compound Name | 2-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]ethanol |
|---|---|
| PubChem CID | 141136392 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]ethanol |
| SMILES | OCCNC/C=C/c1cc(F)ccc1F |
| InChI | InChI=1S/C11H13F2NO/c12-10-3-4-11(13)9(8-10)2-1-5-14-6-7-15/h1-4,8,14-15H,5-7H2/b2-1+ |
| InChIKey | OKJRWXUXDNECED-OWOJBTEDSA-N |
| XLogP | 1.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|